C23H29F3N4O3 — CID 46632417
3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]propanamide (PubChem CID 46632417) has the molecular formula C23H29F3N4O3 and a molecular weight of 466.50 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 46632417 |
| Molecular Formula | C23H29F3N4O3 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCCC2)C1=O)Nc1cc(C(F)(F)F)ccc1N1CCCCC1 |
| InChI | InChI=1S/C23H29F3N4O3/c24-23(25,26)16-7-8-18(29-12-5-2-6-13-29)17(15-16)27-19(31)9-14-30-20(32)22(28-21(30)33)10-3-1-4-11-22/h7-8,15H,1-6,9-14H2,(H,27,31)(H,28,33) |
| InChIKey | NNJLVHASGDXZRF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|