C20H26N4O4 — CID 9154507
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-morpholin-4-ylphenyl)propanamide (PubChem CID 9154507) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-morpholin-4-ylphenyl)propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 9154507 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2-morpholin-4-ylphenyl)propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCC2)C1=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C20H26N4O4/c25-17(7-10-24-18(26)20(22-19(24)27)8-3-4-9-20)21-15-5-1-2-6-16(15)23-11-13-28-14-12-23/h1-2,5-6H,3-4,7-14H2,(H,21,25)(H,22,27) |
| InChIKey | CJAHLYAAMNZEMH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|