C21H28N4O4 — CID 55899568
2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(morpholin-4-ylmethyl)phenyl]acetamide (PubChem CID 55899568) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(morpholin-4-ylmethyl)phenyl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(morpholin-4-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55899568 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-(morpholin-4-ylmethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)Nc1ccccc1CN1CCOCC1 |
| InChI | InChI=1S/C21H28N4O4/c26-18(15-25-19(27)21(23-20(25)28)8-4-1-5-9-21)22-17-7-3-2-6-16(17)14-24-10-12-29-13-11-24/h2-3,6-7H,1,4-5,8-15H2,(H,22,26)(H,23,28) |
| InChIKey | JBHPBHVJQWNHGJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|