C19H22N4O3 — CID 2583832
N-(2-cyanophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide (PubChem CID 2583832) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide.
| Compound Name | N-(2-cyanophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide |
|---|---|
| PubChem CID | 2583832 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-(2-cyanophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetamide |
| SMILES | N#Cc1ccccc1NC(=O)CN1C(=O)NC2(CCCCCCC2)C1=O |
| InChI | InChI=1S/C19H22N4O3/c20-12-14-8-4-5-9-15(14)21-16(24)13-23-17(25)19(22-18(23)26)10-6-2-1-3-7-11-19/h4-5,8-9H,1-3,6-7,10-11,13H2,(H,21,24)(H,22,26) |
| InChIKey | NPBCJEHVMFIQPJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|