C22H20N4O3 — CID 7884244
N-(2-cyanophenyl)-2-[(4S)-4-(2,3-dihydro-1H-inden-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 7884244) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-[(4S)-4-(2,3-dihydro-1H-inden-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-cyanophenyl)-2-[(4S)-4-(2,3-dihydro-1H-inden-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7884244 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-(2-cyanophenyl)-2-[(4S)-4-(2,3-dihydro-1H-inden-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@]1(c2ccc3c(c2)CCC3)NC(=O)N(CC(=O)Nc2ccccc2C#N)C1=O |
| InChI | InChI=1S/C22H20N4O3/c1-22(17-10-9-14-6-4-7-15(14)11-17)20(28)26(21(29)25-22)13-19(27)24-18-8-3-2-5-16(18)12-23/h2-3,5,8-11H,4,6-7,13H2,1H3,(H,24,27)(H,25,29)/t22-/m0/s1 |
| InChIKey | RNDOBWUUYGIHNE-QFIPXVFZSA-N |
| XLogP | 2.45 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|