C16H15ClN4O3 — CID 3625247
N-(5-chloro-2-cyanophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide (PubChem CID 3625247) has the molecular formula C16H15ClN4O3 and a molecular weight of 346.77 g/mol. Its IUPAC name is N-(5-chloro-2-cyanophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide.
| Compound Name | N-(5-chloro-2-cyanophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
|---|---|
| PubChem CID | 3625247 |
| Molecular Formula | C16H15ClN4O3 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-(5-chloro-2-cyanophenyl)-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C16H15ClN4O3/c17-11-4-3-10(8-18)12(7-11)19-13(22)9-21-14(23)16(20-15(21)24)5-1-2-6-16/h3-4,7H,1-2,5-6,9H2,(H,19,22)(H,20,24) |
| InChIKey | FRDJXXOCAJSCJO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|