C15H15ClFN3O5S — CID 91892515
N-(4-chloro-2-fluorophenyl)-2-(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 91892515) has the molecular formula C15H15ClFN3O5S and a molecular weight of 403.82 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 91892515 |
| Molecular Formula | C15H15ClFN3O5S |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCS(=O)(=O)CC2)C1=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H15ClFN3O5S/c16-9-1-2-11(10(17)7-9)18-12(21)8-20-13(22)15(19-14(20)23)3-5-26(24,25)6-4-15/h1-2,7H,3-6,8H2,(H,18,21)(H,19,23) |
| InChIKey | HRUXYXFCJGHUCW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|