C13H13ClFN3O3 — CID 7266305
N-(5-chloro-2-fluorophenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 7266305) has the molecular formula C13H13ClFN3O3 and a molecular weight of 313.72 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 7266305 |
| Molecular Formula | C13H13ClFN3O3 |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CC1(C)NC(=O)N(CC(=O)Nc2cc(Cl)ccc2F)C1=O |
| InChI | InChI=1S/C13H13ClFN3O3/c1-13(2)11(20)18(12(21)17-13)6-10(19)16-9-5-7(14)3-4-8(9)15/h3-5H,6H2,1-2H3,(H,16,19)(H,17,21) |
| InChIKey | GNJNZLJQYHMWFV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|