C14H16FN3O3 — CID 17419729
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(4-fluoro-2-methylphenyl)acetamide (PubChem CID 17419729) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(4-fluoro-2-methylphenyl)acetamide.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(4-fluoro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 17419729 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(4-fluoro-2-methylphenyl)acetamide |
| SMILES | Cc1cc(F)ccc1NC(=O)CN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C14H16FN3O3/c1-8-6-9(15)4-5-10(8)16-11(19)7-18-12(20)14(2,3)17-13(18)21/h4-6H,7H2,1-3H3,(H,16,19)(H,17,21) |
| InChIKey | HELPUIVCIFERSH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|