C17H15ClFN3O4 — CID 47092829
N-(5-chloro-2-fluorophenyl)-2-[4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 47092829) has the molecular formula C17H15ClFN3O4 and a molecular weight of 379.78 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-[4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-[4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 47092829 |
| Molecular Formula | C17H15ClFN3O4 |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-[4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)Nc3cc(Cl)ccc3F)C2=O)o1 |
| InChI | InChI=1S/C17H15ClFN3O4/c1-9-3-6-13(26-9)17(2)15(24)22(16(25)21-17)8-14(23)20-12-7-10(18)4-5-11(12)19/h3-7H,8H2,1-2H3,(H,20,23)(H,21,25) |
| InChIKey | QTIBMIQQDUHNTP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|