C19H21N3O4 — CID 52510822
N-(2,3-dimethylphenyl)-2-[(4S)-4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 52510822) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[(4S)-4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[(4S)-4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 52510822 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[(4S)-4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(C)c3C)C2=O)o1 |
| InChI | InChI=1S/C19H21N3O4/c1-11-6-5-7-14(13(11)3)20-16(23)10-22-17(24)19(4,21-18(22)25)15-9-8-12(2)26-15/h5-9H,10H2,1-4H3,(H,20,23)(H,21,25)/t19-/m0/s1 |
| InChIKey | XARISLZDQBCTEK-IBGZPJMESA-N |
| XLogP | 2.61 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|