C14H18N4O5 — CID 51106021
N-(ethylcarbamoyl)-2-[4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 51106021) has the molecular formula C14H18N4O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-[4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(ethylcarbamoyl)-2-[4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 51106021 |
| Molecular Formula | C14H18N4O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-(ethylcarbamoyl)-2-[4-methyl-4-(5-methylfuran-2-yl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCNC(=O)NC(=O)CN1C(=O)NC(C)(c2ccc(C)o2)C1=O |
| InChI | InChI=1S/C14H18N4O5/c1-4-15-12(21)16-10(19)7-18-11(20)14(3,17-13(18)22)9-6-5-8(2)23-9/h5-6H,4,7H2,1-3H3,(H,17,22)(H2,15,16,19,21) |
| InChIKey | ISGVZKPXNLBPDR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|