C15H17ClN4O4 — CID 2633579
2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(ethylcarbamoyl)acetamide (PubChem CID 2633579) has the molecular formula C15H17ClN4O4 and a molecular weight of 352.78 g/mol. Its IUPAC name is 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(ethylcarbamoyl)acetamide.
| Compound Name | 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(ethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2633579 |
| Molecular Formula | C15H17ClN4O4 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(ethylcarbamoyl)acetamide |
| SMILES | CCNC(=O)NC(=O)CN1C(=O)N[C@@](C)(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C15H17ClN4O4/c1-3-17-13(23)18-11(21)8-20-12(22)15(2,19-14(20)24)9-4-6-10(16)7-5-9/h4-7H,3,8H2,1-2H3,(H,19,24)(H2,17,18,21,23)/t15-/m0/s1 |
| InChIKey | KBSFNWNMSCHGEM-HNNXBMFYSA-N |
| XLogP | 0.95 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|