C18H24N4O4 — CID 2581668
2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylpropylcarbamoyl)acetamide (PubChem CID 2581668) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylpropylcarbamoyl)acetamide.
| Compound Name | 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylpropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2581668 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylpropylcarbamoyl)acetamide |
| SMILES | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)NC(=O)NCC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C18H24N4O4/c1-11(2)9-19-16(25)20-14(23)10-22-15(24)18(4,21-17(22)26)13-7-5-12(3)6-8-13/h5-8,11H,9-10H2,1-4H3,(H,21,26)(H2,19,20,23,25)/t18-/m0/s1 |
| InChIKey | MAYXIEZXQJDGNR-SFHVURJKSA-N |
| XLogP | 1.24 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|