C20H19ClN4O5 — CID 40842811
2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-methoxyphenyl)carbamoyl]acetamide (PubChem CID 40842811) has the molecular formula C20H19ClN4O5 and a molecular weight of 430.85 g/mol. Its IUPAC name is 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-methoxyphenyl)carbamoyl]acetamide.
| Compound Name | 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-methoxyphenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 40842811 |
| Molecular Formula | C20H19ClN4O5 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-methoxyphenyl)carbamoyl]acetamide |
| SMILES | COc1ccc(NC(=O)NC(=O)CN2C(=O)N[C@@](C)(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H19ClN4O5/c1-20(12-3-5-13(21)6-4-12)17(27)25(19(29)24-20)11-16(26)23-18(28)22-14-7-9-15(30-2)10-8-14/h3-10H,11H2,1-2H3,(H,24,29)(H2,22,23,26,28)/t20-/m0/s1 |
| InChIKey | GSOPQYBWIWDJNT-FQEVSTJZSA-N |
| XLogP | 2.46 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|