C24H20ClN3O4 — CID 42964194
2-[4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 42964194) has the molecular formula C24H20ClN3O4 and a molecular weight of 449.89 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 42964194 |
| Molecular Formula | C24H20ClN3O4 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | CC1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)Nc2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C24H20ClN3O4/c1-24(16-7-9-17(25)10-8-16)22(30)28(23(31)27-24)15-21(29)26-18-11-13-20(14-12-18)32-19-5-3-2-4-6-19/h2-14H,15H2,1H3,(H,26,29)(H,27,31) |
| InChIKey | JRRUISYMKCCXQU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|