C29H23N3O4 — CID 42964494
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide (PubChem CID 42964494) has the molecular formula C29H23N3O4 and a molecular weight of 477.52 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 42964494 |
| Molecular Formula | C29H23N3O4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(4-phenoxyphenyl)acetamide |
| SMILES | O=C(CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H23N3O4/c33-26(30-23-16-18-25(19-17-23)36-24-14-8-3-9-15-24)20-32-27(34)29(31-28(32)35,21-10-4-1-5-11-21)22-12-6-2-7-13-22/h1-19H,20H2,(H,30,33)(H,31,35) |
| InChIKey | YOFVSYCYJCIOSR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|