C30H25N3O4 — CID 55463912
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(4-methylphenoxy)phenyl]acetamide (PubChem CID 55463912) has the molecular formula C30H25N3O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(4-methylphenoxy)phenyl]acetamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(4-methylphenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 55463912 |
| Molecular Formula | C30H25N3O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(4-methylphenoxy)phenyl]acetamide |
| SMILES | Cc1ccc(Oc2ccccc2NC(=O)CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C30H25N3O4/c1-21-16-18-24(19-17-21)37-26-15-9-8-14-25(26)31-27(34)20-33-28(35)30(32-29(33)36,22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-19H,20H2,1H3,(H,31,34)(H,32,36) |
| InChIKey | LUAVDCIPSSGYAF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|