C27H27N3O3 — CID 2089214
2-[4,4-bis(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 2089214) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[4,4-bis(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-[4,4-bis(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 2089214 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 2-[4,4-bis(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CN2C(=O)NC(c3ccc(C)cc3)(c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H27N3O3/c1-18-4-10-21(11-5-18)16-28-24(31)17-30-25(32)27(29-26(30)33,22-12-6-19(2)7-13-22)23-14-8-20(3)9-15-23/h4-15H,16-17H2,1-3H3,(H,28,31)(H,29,33) |
| InChIKey | QYBPSILBLZAAPK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|