C26H23Cl2N3O3 — CID 2470081
2-[4,4-bis(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,6-dichloro-3-methylphenyl)acetamide (PubChem CID 2470081) has the molecular formula C26H23Cl2N3O3 and a molecular weight of 496.39 g/mol. Its IUPAC name is 2-[4,4-bis(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,6-dichloro-3-methylphenyl)acetamide.
| Compound Name | 2-[4,4-bis(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,6-dichloro-3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 2470081 |
| Molecular Formula | C26H23Cl2N3O3 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-[4,4-bis(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,6-dichloro-3-methylphenyl)acetamide |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)NC(=O)N(CC(=O)Nc3c(Cl)ccc(C)c3Cl)C2=O)cc1 |
| InChI | InChI=1S/C26H23Cl2N3O3/c1-15-4-9-18(10-5-15)26(19-11-6-16(2)7-12-19)24(33)31(25(34)30-26)14-21(32)29-23-20(27)13-8-17(3)22(23)28/h4-13H,14H2,1-3H3,(H,29,32)(H,30,34) |
| InChIKey | SHDLBSQVSVRRRB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|