C24H21Cl2N3O4 — CID 4880285
N-(2,6-dichloro-3-methylphenyl)-2-[4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 4880285) has the molecular formula C24H21Cl2N3O4 and a molecular weight of 486.36 g/mol. Its IUPAC name is N-(2,6-dichloro-3-methylphenyl)-2-[4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2,6-dichloro-3-methylphenyl)-2-[4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 4880285 |
| Molecular Formula | C24H21Cl2N3O4 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N-(2,6-dichloro-3-methylphenyl)-2-[4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc2cc(C3(C)NC(=O)N(CC(=O)Nc4c(Cl)ccc(C)c4Cl)C3=O)ccc2c1 |
| InChI | InChI=1S/C24H21Cl2N3O4/c1-13-4-9-18(25)21(20(13)26)27-19(30)12-29-22(31)24(2,28-23(29)32)16-7-5-15-11-17(33-3)8-6-14(15)10-16/h4-11H,12H2,1-3H3,(H,27,30)(H,28,32) |
| InChIKey | IOCOLFXFGMXZMO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|