C25H24N2O4 — CID 4787753
3-[2-(2,5-dimethylphenyl)-2-oxoethyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 4787753) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-[2-(2,5-dimethylphenyl)-2-oxoethyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,5-dimethylphenyl)-2-oxoethyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4787753 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 3-[2-(2,5-dimethylphenyl)-2-oxoethyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc2cc(C3(C)NC(=O)N(CC(=O)c4cc(C)ccc4C)C3=O)ccc2c1 |
| InChI | InChI=1S/C25H24N2O4/c1-15-5-6-16(2)21(11-15)22(28)14-27-23(29)25(3,26-24(27)30)19-9-7-18-13-20(31-4)10-8-17(18)12-19/h5-13H,14H2,1-4H3,(H,26,30) |
| InChIKey | WHUFXVIHTCCDTG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|