C24H24N2O4 — CID 8943293
(5S)-3-[(2-methoxy-5-methylphenyl)methyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 8943293) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is (5S)-3-[(2-methoxy-5-methylphenyl)methyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(2-methoxy-5-methylphenyl)methyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8943293 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (5S)-3-[(2-methoxy-5-methylphenyl)methyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc2cc([C@]3(C)NC(=O)N(Cc4cc(C)ccc4OC)C3=O)ccc2c1 |
| InChI | InChI=1S/C24H24N2O4/c1-15-5-10-21(30-4)18(11-15)14-26-22(27)24(2,25-23(26)28)19-8-6-17-13-20(29-3)9-7-16(17)12-19/h5-13H,14H2,1-4H3,(H,25,28)/t24-/m0/s1 |
| InChIKey | HXMBGRLYPHJMFP-DEOSSOPVSA-N |
| XLogP | 4.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|