C22H19ClN2O3 — CID 8001244
(5S)-3-[(2-chlorophenyl)methyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 8001244) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is (5S)-3-[(2-chlorophenyl)methyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(2-chlorophenyl)methyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8001244 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (5S)-3-[(2-chlorophenyl)methyl]-5-(6-methoxynaphthalen-2-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc2cc([C@]3(C)NC(=O)N(Cc4ccccc4Cl)C3=O)ccc2c1 |
| InChI | InChI=1S/C22H19ClN2O3/c1-22(17-9-7-15-12-18(28-2)10-8-14(15)11-17)20(26)25(21(27)24-22)13-16-5-3-4-6-19(16)23/h3-12H,13H2,1-2H3,(H,24,27)/t22-/m0/s1 |
| InChIKey | ZNMNEDFMWZTLLK-QFIPXVFZSA-N |
| XLogP | 4.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|