C29H25N3O4 — CID 46665850
2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[2-(4-methylphenoxy)phenyl]acetamide (PubChem CID 46665850) has the molecular formula C29H25N3O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[2-(4-methylphenoxy)phenyl]acetamide.
| Compound Name | 2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[2-(4-methylphenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 46665850 |
| Molecular Formula | C29H25N3O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[2-(4-methylphenoxy)phenyl]acetamide |
| SMILES | Cc1ccc(Oc2ccccc2NC(=O)CN2C(=O)NC(C)(c3cccc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C29H25N3O4/c1-19-14-16-21(17-15-19)36-25-13-6-5-12-24(25)30-26(33)18-32-27(34)29(2,31-28(32)35)23-11-7-9-20-8-3-4-10-22(20)23/h3-17H,18H2,1-2H3,(H,30,33)(H,31,35) |
| InChIKey | RGGGHFZNSDNTBB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|