C28H25N3O3S — CID 60601630
2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[(4-methylphenyl)-thiophen-2-ylmethyl]acetamide (PubChem CID 60601630) has the molecular formula C28H25N3O3S and a molecular weight of 483.59 g/mol. Its IUPAC name is 2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[(4-methylphenyl)-thiophen-2-ylmethyl]acetamide.
| Compound Name | 2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[(4-methylphenyl)-thiophen-2-ylmethyl]acetamide |
|---|---|
| PubChem CID | 60601630 |
| Molecular Formula | C28H25N3O3S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)-N-[(4-methylphenyl)-thiophen-2-ylmethyl]acetamide |
| SMILES | Cc1ccc(C(NC(=O)CN2C(=O)NC(C)(c3cccc4ccccc34)C2=O)c2cccs2)cc1 |
| InChI | InChI=1S/C28H25N3O3S/c1-18-12-14-20(15-13-18)25(23-11-6-16-35-23)29-24(32)17-31-26(33)28(2,30-27(31)34)22-10-5-8-19-7-3-4-9-21(19)22/h3-16,25H,17H2,1-2H3,(H,29,32)(H,30,34) |
| InChIKey | SQYGOCXRJFBDOC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|