C26H21N3O3 — CID 41183201
2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-naphthalen-1-ylacetamide (PubChem CID 41183201) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 41183201 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-naphthalen-1-ylacetamide |
| SMILES | C[C@@]1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)Nc2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C26H21N3O3/c1-26(20-14-13-17-7-2-3-9-19(17)15-20)24(31)29(25(32)28-26)16-23(30)27-22-12-6-10-18-8-4-5-11-21(18)22/h2-15H,16H2,1H3,(H,27,30)(H,28,32)/t26-/m0/s1 |
| InChIKey | FSAQRTHQLUMRJT-SANMLTNESA-N |
| XLogP | 4.40 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|