C23H20FN3O3 — CID 16546321
N-[(4-fluorophenyl)methyl]-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 16546321) has the molecular formula C23H20FN3O3 and a molecular weight of 405.43 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 16546321 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CC1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)NCc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C23H20FN3O3/c1-23(18-9-8-16-4-2-3-5-17(16)12-18)21(29)27(22(30)26-23)14-20(28)25-13-15-6-10-19(24)11-7-15/h2-12H,13-14H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | KZIYNYBDJWRFSN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|