C28H24N4O4 — CID 55495846
N'-[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]-2-naphthalen-1-ylacetohydrazide (PubChem CID 55495846) has the molecular formula C28H24N4O4 and a molecular weight of 480.52 g/mol. Its IUPAC name is N'-[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]-2-naphthalen-1-ylacetohydrazide.
| Compound Name | N'-[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]-2-naphthalen-1-ylacetohydrazide |
|---|---|
| PubChem CID | 55495846 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N'-[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]-2-naphthalen-1-ylacetohydrazide |
| SMILES | CC1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)NNC(=O)Cc2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C28H24N4O4/c1-28(22-14-13-18-7-2-3-9-20(18)15-22)26(35)32(27(36)29-28)17-25(34)31-30-24(33)16-21-11-6-10-19-8-4-5-12-23(19)21/h2-15H,16-17H2,1H3,(H,29,36)(H,30,33)(H,31,34) |
| InChIKey | GGAWZBHCJNCGCK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|