C23H29N3O3 — CID 40748919
N-[(2R)-5-methylhexan-2-yl]-2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 40748919) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[(2R)-5-methylhexan-2-yl]-2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(2R)-5-methylhexan-2-yl]-2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 40748919 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[(2R)-5-methylhexan-2-yl]-2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(C)CC[C@@H](C)NC(=O)CN1C(=O)N[C@](C)(c2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C23H29N3O3/c1-15(2)9-10-16(3)24-20(27)14-26-21(28)23(4,25-22(26)29)19-12-11-17-7-5-6-8-18(17)13-19/h5-8,11-13,15-16H,9-10,14H2,1-4H3,(H,24,27)(H,25,29)/t16-,23-/m1/s1 |
| InChIKey | KVSJKMWZCNWXKV-WAIKUNEKSA-N |
| XLogP | 3.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|