C24H29N3O5 — CID 95781047
methyl (2S)-3-ethyl-2-[[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]pentanoate (PubChem CID 95781047) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is methyl (2S)-3-ethyl-2-[[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]pentanoate.
| Compound Name | methyl (2S)-3-ethyl-2-[[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 95781047 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | methyl (2S)-3-ethyl-2-[[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]pentanoate |
| SMILES | CCC(CC)[C@H](NC(=O)CN1C(=O)N[C@](C)(c2ccc3ccccc3c2)C1=O)C(=O)OC |
| InChI | InChI=1S/C24H29N3O5/c1-5-15(6-2)20(21(29)32-4)25-19(28)14-27-22(30)24(3,26-23(27)31)18-12-11-16-9-7-8-10-17(16)13-18/h7-13,15,20H,5-6,14H2,1-4H3,(H,25,28)(H,26,31)/t20-,24+/m0/s1 |
| InChIKey | PFGPCJULANCBDK-GBXCKJPGSA-N |
| XLogP | 2.70 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|