C25H24N4O6 — CID 40943642
3,5-dimethoxy-N'-[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]benzohydrazide (PubChem CID 40943642) has the molecular formula C25H24N4O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is 3,5-dimethoxy-N'-[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]benzohydrazide.
| Compound Name | 3,5-dimethoxy-N'-[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 40943642 |
| Molecular Formula | C25H24N4O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 3,5-dimethoxy-N'-[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]benzohydrazide |
| SMILES | COc1cc(OC)cc(C(=O)NNC(=O)CN2C(=O)N[C@](C)(c3ccc4ccccc4c3)C2=O)c1 |
| InChI | InChI=1S/C25H24N4O6/c1-25(18-9-8-15-6-4-5-7-16(15)10-18)23(32)29(24(33)26-25)14-21(30)27-28-22(31)17-11-19(34-2)13-20(12-17)35-3/h4-13H,14H2,1-3H3,(H,26,33)(H,27,30)(H,28,31)/t25-/m1/s1 |
| InChIKey | JJJWCSSCGSUSPU-RUZDIDTESA-N |
| XLogP | 2.09 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|