C28H23N3O4 — CID 25436664
2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 25436664) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 25436664 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | C[C@]1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)Nc2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C28H23N3O4/c1-28(21-12-11-19-7-5-6-8-20(19)17-21)26(33)31(27(34)30-28)18-25(32)29-22-13-15-24(16-14-22)35-23-9-3-2-4-10-23/h2-17H,18H2,1H3,(H,29,32)(H,30,34)/t28-/m1/s1 |
| InChIKey | RFXIWKHZFKMPFO-MUUNZHRXSA-N |
| XLogP | 5.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|