C24H24N4O5S — CID 2107483
N-[4-(dimethylsulfamoyl)phenyl]-2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 2107483) has the molecular formula C24H24N4O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 2107483 |
| Molecular Formula | C24H24N4O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)CN2C(=O)N[C@@](C)(c3ccc4ccccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C24H24N4O5S/c1-24(18-9-8-16-6-4-5-7-17(16)14-18)22(30)28(23(31)26-24)15-21(29)25-19-10-12-20(13-11-19)34(32,33)27(2)3/h4-14H,15H2,1-3H3,(H,25,29)(H,26,31)/t24-/m0/s1 |
| InChIKey | WHUCEYRHYWNKNH-DEOSSOPVSA-N |
| XLogP | 2.50 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|