C24H22N4O7S — CID 25415299
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 25415299) has the molecular formula C24H22N4O7S and a molecular weight of 510.53 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 25415299 |
| Molecular Formula | C24H22N4O7S |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | C[C@@]1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C24H22N4O7S/c1-24(17-7-6-15-4-2-3-5-16(15)12-17)22(31)28(23(32)27-24)13-21(30)35-14-20(29)26-18-8-10-19(11-9-18)36(25,33)34/h2-12H,13-14H2,1H3,(H,26,29)(H,27,32)(H2,25,33,34)/t24-/m0/s1 |
| InChIKey | NOFVGPKNWJDUJP-DEOSSOPVSA-N |
| XLogP | 1.44 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|