C31H28N4O5 — CID 98396447
N-(4-ethoxyphenyl)-4-[[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide (PubChem CID 98396447) has the molecular formula C31H28N4O5 and a molecular weight of 536.59 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-[[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-(4-ethoxyphenyl)-4-[[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 98396447 |
| Molecular Formula | C31H28N4O5 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-[[2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NC(=O)CN3C(=O)N[C@](C)(c4ccc5ccccc5c4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C31H28N4O5/c1-3-40-26-16-14-25(15-17-26)33-28(37)21-9-12-24(13-10-21)32-27(36)19-35-29(38)31(2,34-30(35)39)23-11-8-20-6-4-5-7-22(20)18-23/h4-18H,3,19H2,1-2H3,(H,32,36)(H,33,37)(H,34,39)/t31-/m1/s1 |
| InChIKey | YBKLVPDXTNIAJW-WJOKGBTCSA-N |
| XLogP | 4.90 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|