C23H18F3N3O4 — CID 2459874
2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 2459874) has the molecular formula C23H18F3N3O4 and a molecular weight of 457.41 g/mol. Its IUPAC name is 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 2459874 |
| Molecular Formula | C23H18F3N3O4 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[(4R)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | C[C@]1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)Nc2ccc(OC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C23H18F3N3O4/c1-22(16-7-6-14-4-2-3-5-15(14)12-16)20(31)29(21(32)28-22)13-19(30)27-17-8-10-18(11-9-17)33-23(24,25)26/h2-12H,13H2,1H3,(H,27,30)(H,28,32)/t22-/m1/s1 |
| InChIKey | WHZXEJVYENSONB-JOCHJYFZSA-N |
| XLogP | 4.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|