C27H28N4O4 — CID 24657513
2,2-dimethyl-N-[3-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]phenyl]propanamide (PubChem CID 24657513) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]phenyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[3-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 24657513 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2,2-dimethyl-N-[3-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]phenyl]propanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(NC(=O)CN2C(=O)NC(C)(c3ccc4ccccc4c3)C2=O)c1 |
| InChI | InChI=1S/C27H28N4O4/c1-26(2,3)23(33)29-21-11-7-10-20(15-21)28-22(32)16-31-24(34)27(4,30-25(31)35)19-13-12-17-8-5-6-9-18(17)14-19/h5-15H,16H2,1-4H3,(H,28,32)(H,29,33)(H,30,35) |
| InChIKey | ABTHNMZRSFNOBG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|