C20H21N5O5 — CID 55539585
N-[3-(carbamoylamino)phenyl]-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 55539585) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-[3-(carbamoylamino)phenyl]-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[3-(carbamoylamino)phenyl]-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55539585 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-[3-(carbamoylamino)phenyl]-2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc(C2(C)NC(=O)N(CC(=O)Nc3cccc(NC(N)=O)c3)C2=O)cc1 |
| InChI | InChI=1S/C20H21N5O5/c1-20(12-6-8-15(30-2)9-7-12)17(27)25(19(29)24-20)11-16(26)22-13-4-3-5-14(10-13)23-18(21)28/h3-10H,11H2,1-2H3,(H,22,26)(H,24,29)(H3,21,23,28) |
| InChIKey | NDCRZTDZRIMAEU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|