C22H25N3O4 — CID 40857215
2-[(4R)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 40857215) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[(4R)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 40857215 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[(4R)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | COc1ccc([C@@]2(C)NC(=O)N(CC(=O)Nc3ccc(C(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H25N3O4/c1-14(2)15-5-9-17(10-6-15)23-19(26)13-25-20(27)22(3,24-21(25)28)16-7-11-18(29-4)12-8-16/h5-12,14H,13H2,1-4H3,(H,23,26)(H,24,28)/t22-/m1/s1 |
| InChIKey | DCKVBBPWTPHHBN-JOCHJYFZSA-N |
| XLogP | 3.22 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|