C21H20N6O4 — CID 55567215
2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,2,4-triazol-1-yl)phenyl]acetamide (PubChem CID 55567215) has the molecular formula C21H20N6O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,2,4-triazol-1-yl)phenyl]acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,2,4-triazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55567215 |
| Molecular Formula | C21H20N6O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(1,2,4-triazol-1-yl)phenyl]acetamide |
| SMILES | COc1ccc(C2(C)NC(=O)N(CC(=O)Nc3ccc(-n4cncn4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H20N6O4/c1-21(14-3-9-17(31-2)10-4-14)19(29)26(20(30)25-21)11-18(28)24-15-5-7-16(8-6-15)27-13-22-12-23-27/h3-10,12-13H,11H2,1-2H3,(H,24,28)(H,25,30) |
| InChIKey | VGRKTOXCJQTJLR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|