C24H27N3O6 — CID 24672758
butyl 4-[[2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate (PubChem CID 24672758) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is butyl 4-[[2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 24672758 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | butyl 4-[[2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CN2C(=O)NC(C)(c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H27N3O6/c1-4-5-14-33-21(29)16-6-10-18(11-7-16)25-20(28)15-27-22(30)24(2,26-23(27)31)17-8-12-19(32-3)13-9-17/h6-13H,4-5,14-15H2,1-3H3,(H,25,28)(H,26,31) |
| InChIKey | CTZHETZFCPLBGK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|