C28H29N3O6 — CID 26058006
butyl 4-[[2-[(4R)-4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate (PubChem CID 26058006) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is butyl 4-[[2-[(4R)-4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[(4R)-4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 26058006 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | butyl 4-[[2-[(4R)-4-(6-methoxynaphthalen-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CN2C(=O)N[C@](C)(c3ccc4cc(OC)ccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C28H29N3O6/c1-4-5-14-37-25(33)18-7-11-22(12-8-18)29-24(32)17-31-26(34)28(2,30-27(31)35)21-10-6-20-16-23(36-3)13-9-19(20)15-21/h6-13,15-16H,4-5,14,17H2,1-3H3,(H,29,32)(H,30,35)/t28-/m1/s1 |
| InChIKey | BFVHXNWFQBZNAN-MUUNZHRXSA-N |
| XLogP | 4.21 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|