C26H24N4O6 — CID 55396903
methyl 2-[[4-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoyl]amino]acetate (PubChem CID 55396903) has the molecular formula C26H24N4O6 and a molecular weight of 488.50 g/mol. Its IUPAC name is methyl 2-[[4-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55396903 |
| Molecular Formula | C26H24N4O6 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | methyl 2-[[4-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)CN2C(=O)NC(C)(c3ccc4ccccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C26H24N4O6/c1-26(19-10-7-16-5-3-4-6-18(16)13-19)24(34)30(25(35)29-26)15-21(31)28-20-11-8-17(9-12-20)23(33)27-14-22(32)36-2/h3-13H,14-15H2,1-2H3,(H,27,33)(H,28,31)(H,29,35) |
| InChIKey | KUUAZBNNYGHTRS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|