C21H23N3O5 — CID 55600305
methyl 2-methyl-2-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoate (PubChem CID 55600305) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl 2-methyl-2-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoate.
| Compound Name | methyl 2-methyl-2-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 55600305 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | methyl 2-methyl-2-[[2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)CN1C(=O)NC(C)(c2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C21H23N3O5/c1-20(2,18(27)29-4)22-16(25)12-24-17(26)21(3,23-19(24)28)15-10-9-13-7-5-6-8-14(13)11-15/h5-11H,12H2,1-4H3,(H,22,25)(H,23,28) |
| InChIKey | MZJVPZXYLKCJMD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|