C20H20N4O5 — CID 55419227
2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(phenylcarbamoyl)acetamide (PubChem CID 55419227) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(phenylcarbamoyl)acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(phenylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 55419227 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(phenylcarbamoyl)acetamide |
| SMILES | COc1ccc(C2(C)NC(=O)N(CC(=O)NC(=O)Nc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C20H20N4O5/c1-20(13-8-10-15(29-2)11-9-13)17(26)24(19(28)23-20)12-16(25)22-18(27)21-14-6-4-3-5-7-14/h3-11H,12H2,1-2H3,(H,23,28)(H2,21,22,25,27) |
| InChIKey | TWLLYJJBPXVJQA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|