C16H19N3O6 — CID 119943115
(2S)-2-[[2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]propanoic acid (PubChem CID 119943115) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is (2S)-2-[[2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119943115 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (2S)-2-[[2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]propanoic acid |
| SMILES | COc1ccc(C2(C)NC(=O)N(CC(=O)N[C@@H](C)C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C16H19N3O6/c1-9(13(21)22)17-12(20)8-19-14(23)16(2,18-15(19)24)10-4-6-11(25-3)7-5-10/h4-7,9H,8H2,1-3H3,(H,17,20)(H,18,24)(H,21,22)/t9-,16?/m0/s1 |
| InChIKey | SMALYBAHQUZHMC-XUOZKRPMSA-N |
| XLogP | 0.05 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|