C24H26N4O4 — CID 46665792
2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(4-methoxyphenyl)-2-methylpropyl]acetamide (PubChem CID 46665792) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(4-methoxyphenyl)-2-methylpropyl]acetamide.
| Compound Name | 2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(4-methoxyphenyl)-2-methylpropyl]acetamide |
|---|---|
| PubChem CID | 46665792 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[4-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(4-methoxyphenyl)-2-methylpropyl]acetamide |
| SMILES | COc1ccc(C(NC(=O)CN2C(=O)NC(C)(c3ccc(C#N)cc3)C2=O)C(C)C)cc1 |
| InChI | InChI=1S/C24H26N4O4/c1-15(2)21(17-7-11-19(32-4)12-8-17)26-20(29)14-28-22(30)24(3,27-23(28)31)18-9-5-16(13-25)6-10-18/h5-12,15,21H,14H2,1-4H3,(H,26,29)(H,27,31) |
| InChIKey | ONAAPKSQIAYPAG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|