C22H22Cl2FN3O3 — CID 46670398
2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(4-fluorophenyl)-2-methylpropyl]acetamide (PubChem CID 46670398) has the molecular formula C22H22Cl2FN3O3 and a molecular weight of 466.34 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(4-fluorophenyl)-2-methylpropyl]acetamide.
| Compound Name | 2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(4-fluorophenyl)-2-methylpropyl]acetamide |
|---|---|
| PubChem CID | 46670398 |
| Molecular Formula | C22H22Cl2FN3O3 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(4-fluorophenyl)-2-methylpropyl]acetamide |
| SMILES | CC(C)C(NC(=O)CN1C(=O)NC(C)(c2ccc(Cl)c(Cl)c2)C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22Cl2FN3O3/c1-12(2)19(13-4-7-15(25)8-5-13)26-18(29)11-28-20(30)22(3,27-21(28)31)14-6-9-16(23)17(24)10-14/h4-10,12,19H,11H2,1-3H3,(H,26,29)(H,27,31) |
| InChIKey | UAGJHHOOBMCWTQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|