C23H26N4O6 — CID 46665832
N-[1-(4-methoxyphenyl)-2-methylpropyl]-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 46665832) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)-2-methylpropyl]-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[1-(4-methoxyphenyl)-2-methylpropyl]-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 46665832 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-[1-(4-methoxyphenyl)-2-methylpropyl]-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc(C(NC(=O)CN2C(=O)NC(C)(c3ccc([N+](=O)[O-])cc3)C2=O)C(C)C)cc1 |
| InChI | InChI=1S/C23H26N4O6/c1-14(2)20(15-5-11-18(33-4)12-6-15)24-19(28)13-26-21(29)23(3,25-22(26)30)16-7-9-17(10-8-16)27(31)32/h5-12,14,20H,13H2,1-4H3,(H,24,28)(H,25,30) |
| InChIKey | DOAOWYOYMUUUHK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|